C12H22N2O — CID 154980878
2-tert-butyl-5-methyl-1,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 154980878) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-1,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 2-tert-butyl-5-methyl-1,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 154980878 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-tert-butyl-5-methyl-1,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | CN1CCC2CN(C(C)(C)C)C(=O)C2C1 |
| InChI | InChI=1S/C12H22N2O/c1-12(2,3)14-7-9-5-6-13(4)8-10(9)11(14)15/h9-10H,5-8H2,1-4H3 |
| InChIKey | ZCSXFWOWZKEJST-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |