C15H25N3O2 — CID 138384072
(3aR,7aS)-2-(1-acetylpiperidin-4-yl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 138384072) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is (3aR,7aS)-2-(1-acetylpiperidin-4-yl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-2-(1-acetylpiperidin-4-yl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 138384072 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (3aR,7aS)-2-(1-acetylpiperidin-4-yl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | CC(=O)N1CCC(N2C[C@H]3CCN(C)C(=O)[C@H]3C2)CC1 |
| InChI | InChI=1S/C15H25N3O2/c1-11(19)17-7-4-13(5-8-17)18-9-12-3-6-16(2)15(20)14(12)10-18/h12-14H,3-10H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | SPRYBSMVFYNBRS-OCCSQVGLSA-N |
| XLogP | 0.41 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |