C19H30N2O2 — CID 11120734
1-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]imidazolidine-2,4-dione (PubChem CID 11120734) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]imidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11120734 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]imidazolidine-2,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C19H30N2O2/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-21-18(22)14-20(5)19(21)23/h8,10,12H,6-7,9,11,13-14H2,1-5H3/b16-10+,17-12+ |
| InChIKey | GALRDKBLTNSOSJ-JTCWOHKRSA-N |
| XLogP | 4.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|