C19H23NO — CID 139668123
1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole-3-carbaldehyde (PubChem CID 139668123) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole-3-carbaldehyde.
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 139668123 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole-3-carbaldehyde |
| SMILES | CC(C)=CCC/C(C)=C/Cn1cc(C=O)c2ccccc21 |
| InChI | InChI=1S/C19H23NO/c1-15(2)7-6-8-16(3)11-12-20-13-17(14-21)18-9-4-5-10-19(18)20/h4-5,7,9-11,13-14H,6,8,12H2,1-3H3/b16-11+ |
| InChIKey | WTUAUARNZKIELF-LFIBNONCSA-N |
| XLogP | 5.15 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|