C17H22N2O2 — CID 70409517
1-[4-(1,4-dioxan-2-yl)-3-methylbut-2-enyl]-2-methylbenzimidazole (PubChem CID 70409517) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-[4-(1,4-dioxan-2-yl)-3-methylbut-2-enyl]-2-methylbenzimidazole.
| Compound Name | 1-[4-(1,4-dioxan-2-yl)-3-methylbut-2-enyl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 70409517 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[4-(1,4-dioxan-2-yl)-3-methylbut-2-enyl]-2-methylbenzimidazole |
| SMILES | CC(=CCn1c(C)nc2ccccc21)CC1COCCO1 |
| InChI | InChI=1S/C17H22N2O2/c1-13(11-15-12-20-9-10-21-15)7-8-19-14(2)18-16-5-3-4-6-17(16)19/h3-7,15H,8-12H2,1-2H3 |
| InChIKey | IUBJXKXNMBOIEC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|