C18H17N3O3S — CID 8755238
2-[[2-[[(R)-furan-2-yl(phenyl)methyl]amino]acetyl]amino]thiophene-3-carboxamide (PubChem CID 8755238) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[[2-[[(R)-furan-2-yl(phenyl)methyl]amino]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[[(R)-furan-2-yl(phenyl)methyl]amino]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 8755238 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[[2-[[(R)-furan-2-yl(phenyl)methyl]amino]acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CN[C@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C18H17N3O3S/c19-17(23)13-8-10-25-18(13)21-15(22)11-20-16(14-7-4-9-24-14)12-5-2-1-3-6-12/h1-10,16,20H,11H2,(H2,19,23)(H,21,22)/t16-/m1/s1 |
| InChIKey | LPWXXHOBBJQABH-MRXNPFEDSA-N |
| XLogP | 2.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |