About ethenyl 4-(butylamino)butanoate
ethenyl 4-(butylamino)butanoate (PubChem CID 87552955) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is ethenyl 4-(butylamino)butanoate.
Molecular Properties
| Compound Name | ethenyl 4-(butylamino)butanoate |
| PubChem CID | 87552955 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | ethenyl 4-(butylamino)butanoate |
| SMILES | C=COC(=O)CCCNCCCC |
| InChI | InChI=1S/C10H19NO2/c1-3-5-8-11-9-6-7-10(12)13-4-2/h4,11H,2-3,5-9H2,1H3 |
| InChIKey | ATHQPZVKSSLIBE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 4-(butylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 4-(butylamino)butanoate?
The IUPAC name of ethenyl 4-(butylamino)butanoate (CID 87552955) is ethenyl 4-(butylamino)butanoate.
What is the SMILES notation for ethenyl 4-(butylamino)butanoate?
The canonical SMILES for ethenyl 4-(butylamino)butanoate is C=COC(=O)CCCNCCCC.
What is the InChIKey of ethenyl 4-(butylamino)butanoate?
The InChIKey is ATHQPZVKSSLIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-3-5-8-11-9-6-7-10(12)13-4-2/h4,11H,2-3,5-9H2,1H3.
What are the key properties of ethenyl 4-(butylamino)butanoate?
ethenyl 4-(butylamino)butanoate has a molecular weight of 185.27 g/mol, XLogP of 1.84, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 4-(butylamino)butanoate is sourced from PubChem (CID 87552955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).