C18H23N3O3 — CID 8755412
2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-(2-methylpropylcarbamoyl)acetamide (PubChem CID 8755412) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-(2-methylpropylcarbamoyl)acetamide.
| Compound Name | 2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-(2-methylpropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8755412 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-(2-methylpropylcarbamoyl)acetamide |
| SMILES | CC(C)CNC(=O)NC(=O)CN[C@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C18H23N3O3/c1-13(2)11-20-18(23)21-16(22)12-19-17(15-9-6-10-24-15)14-7-4-3-5-8-14/h3-10,13,17,19H,11-12H2,1-2H3,(H2,20,21,22,23)/t17-/m1/s1 |
| InChIKey | YLPPDPJRCGODAJ-QGZVFWFLSA-N |
| XLogP | 2.44 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |