C25H24N2O2 — CID 8755940
2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-[(1R)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 8755940) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-[(1R)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-[(1R)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 8755940 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-[(1R)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CN[C@H](c1ccccc1)c1ccco1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H24N2O2/c1-18(21-14-13-19-8-5-6-11-22(19)16-21)27-24(28)17-26-25(23-12-7-15-29-23)20-9-3-2-4-10-20/h2-16,18,25-26H,17H2,1H3,(H,27,28)/t18-,25-/m1/s1 |
| InChIKey | WLHFMOOBXQQBOP-IQGLISFBSA-N |
| XLogP | 4.99 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |