C6H8O6S2 — CID 87555090
cyclohexa-3,5-diene-1,2-disulfonic acid (PubChem CID 87555090) has the molecular formula C6H8O6S2 and a molecular weight of 240.26 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-disulfonic acid.
| Compound Name | cyclohexa-3,5-diene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 87555090 |
| Molecular Formula | C6H8O6S2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)C1C=CC=CC1S(=O)(=O)O |
| InChI | InChI=1S/C6H8O6S2/c7-13(8,9)5-3-1-2-4-6(5)14(10,11)12/h1-6H,(H,7,8,9)(H,10,11,12) |
| InChIKey | IDFZXEFTTPPULO-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|