C6H10N2NaO3S — CID 172830707
CID 172830707 (PubChem CID 172830707) has the molecular formula C6H10N2NaO3S and a molecular weight of 213.21 g/mol.
| Compound Name | CID 172830707 |
|---|---|
| PubChem CID | 172830707 |
| Molecular Formula | C6H10N2NaO3S |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | — |
| SMILES | NC1C=CC=CC1(N)S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C6H10N2O3S.Na/c7-5-3-1-2-4-6(5,8)12(9,10)11;/h1-5H,7-8H2,(H,9,10,11); |
| InChIKey | VLYPQMBJAHZEEU-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|