C17H13ClF2N2O3 — CID 87555366
N-(6-chloro-4-methyl-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide (PubChem CID 87555366) has the molecular formula C17H13ClF2N2O3 and a molecular weight of 366.75 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | N-(6-chloro-4-methyl-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 87555366 |
| Molecular Formula | C17H13ClF2N2O3 |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(6-chloro-4-methyl-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(Cl)nc(NC(=O)C2(c3ccc4c(c3)OC(F)(F)O4)CC2)c1 |
| InChI | InChI=1S/C17H13ClF2N2O3/c1-9-6-13(18)21-14(7-9)22-15(23)16(4-5-16)10-2-3-11-12(8-10)25-17(19,20)24-11/h2-3,6-8H,4-5H2,1H3,(H,21,22,23) |
| InChIKey | XPSDGAIEURAGPR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|