C19H17ClF2N2O2 — CID 89228843
6-chloro-N-[1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]ethenyl]-4,5-dimethylpyridin-2-amine (PubChem CID 89228843) has the molecular formula C19H17ClF2N2O2 and a molecular weight of 378.81 g/mol. Its IUPAC name is 6-chloro-N-[1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]ethenyl]-4,5-dimethylpyridin-2-amine.
| Compound Name | 6-chloro-N-[1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]ethenyl]-4,5-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 89228843 |
| Molecular Formula | C19H17ClF2N2O2 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 6-chloro-N-[1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]ethenyl]-4,5-dimethylpyridin-2-amine |
| SMILES | C=C(Nc1cc(C)c(C)c(Cl)n1)C1(c2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C19H17ClF2N2O2/c1-10-8-16(24-17(20)11(10)2)23-12(3)18(6-7-18)13-4-5-14-15(9-13)26-19(21,22)25-14/h4-5,8-9H,3,6-7H2,1-2H3,(H,23,24) |
| InChIKey | PAFZKTBODPNEEW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|