C8H9F3O4 — CID 87557802
methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate (PubChem CID 87557802) has the molecular formula C8H9F3O4 and a molecular weight of 226.15 g/mol. Its IUPAC name is methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate.
| Compound Name | methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate |
|---|---|
| PubChem CID | 87557802 |
| Molecular Formula | C8H9F3O4 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate |
| SMILES | CO/C(=C\CC(=O)C(F)(F)F)/C(=O)OC |
| InChI | InChI=1S/C8H9F3O4/c1-14-5(7(13)15-2)3-4-6(12)8(9,10)11/h3H,4H2,1-2H3/b5-3- |
| InChIKey | MJTRGVOEGVLXRK-HYXAFXHYSA-N |
| XLogP | 1.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | 280 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|