methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate

C8H9F3O4 — CID 87557802

IUPACmethyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate
SMILESCOC(=O)/C(=C/CC(=O)C(F)(F)F)OC
InChIInChI=1S/C8H9F3O4/c1-14-5(7(13)15-2)3-4-6(12)8(9,10)11/h3H,4H2,1-2H3/b5-3-
InChIKeyMJTRGVOEGVLXRK-HYXAFXHYSA-N
MW226.15 g/mol
LogP1.21
Rot. Bonds4

About methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate

methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate (PubChem CID 87557802) has the molecular formula C8H9F3O4 and a molecular weight of 226.15 g/mol. Its IUPAC name is methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate.

Molecular Properties

Compound Namemethyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate
PubChem CID87557802
Molecular FormulaC8H9F3O4
Molecular Weight226.15 g/mol
Exact Mass226.05
IUPAC Namemethyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate
SMILESCOC(=O)/C(=C/CC(=O)C(F)(F)F)OC
InChIInChI=1S/C8H9F3O4/c1-14-5(7(13)15-2)3-4-6(12)8(9,10)11/h3H,4H2,1-2H3/b5-3-
InChIKeyMJTRGVOEGVLXRK-HYXAFXHYSA-N
XLogP1.21
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.15
LogP ≤ 51.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate?
The IUPAC name of methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate (CID 87557802) is methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate.
What is the SMILES notation for methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate?
The canonical SMILES for methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate is COC(=O)/C(=C/CC(=O)C(F)(F)F)OC.
What is the InChIKey of methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate?
The InChIKey is MJTRGVOEGVLXRK-HYXAFXHYSA-N. The full InChI is InChI=1S/C8H9F3O4/c1-14-5(7(13)15-2)3-4-6(12)8(9,10)11/h3H,4H2,1-2H3/b5-3-.
What are the key properties of methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate?
methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate has a molecular weight of 226.15 g/mol, XLogP of 1.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-6,6,6-trifluoro-2-methoxy-5-oxohex-2-enoate is sourced from PubChem (CID 87557802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).