About Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate
Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate (PubChem CID 175997289) has the molecular formula C8H9F3O3
and a molecular weight of 210.15 g/mol. Its IUPAC name is ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate.
Analyze Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate?
The IUPAC name of Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate (CID 175997289) is ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate.
What is the SMILES notation for Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate?
The canonical SMILES for Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate is CCOC(=O)C1=CCC(O1)C(F)(F)F.
What is the InChIKey of Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate?
The InChIKey is WPRCMTUWZFTBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3O3/c1-2-13-7(12)5-3-4-6(14-5)8(9,10)11/h3,6H,2,4H2,1H3.
What are the key properties of Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate?
Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate has a molecular weight of 210.15 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 2-(trifluoromethyl)-2,3-dihydrofuran-5-carboxylate is sourced from PubChem (CID 175997289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).