C20H36O3P+ — CID 87558656
[(9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienoxy]-hydroxy-oxophosphanium (PubChem CID 87558656) has the molecular formula C20H36O3P+ and a molecular weight of 355.48 g/mol. Its IUPAC name is [(9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienoxy]-hydroxy-oxophosphanium.
| Compound Name | [(9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87558656 |
| Molecular Formula | C20H36O3P+ |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | [(9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienoxy]-hydroxy-oxophosphanium |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(CC)CO[P+](=O)O |
| InChI | InChI=1S/C20H35O3P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(4-2)19-23-24(21)22/h5-6,8-9,11-12,20H,3-4,7,10,13-19H2,1-2H3/p+1/b6-5-,9-8-,12-11- |
| InChIKey | FWDAOAAKCIBTIO-AGRJPVHOSA-O |
| XLogP | 6.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|