C6H6N6O2 — CID 87559469
(E)-2,3-dicyanobut-2-enedihydrazide (PubChem CID 87559469) has the molecular formula C6H6N6O2 and a molecular weight of 194.15 g/mol. Its IUPAC name is (E)-2,3-dicyanobut-2-enedihydrazide.
| Compound Name | (E)-2,3-dicyanobut-2-enedihydrazide |
|---|---|
| PubChem CID | 87559469 |
| Molecular Formula | C6H6N6O2 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (E)-2,3-dicyanobut-2-enedihydrazide |
| SMILES | N#C/C(C(=O)NN)=C(/C#N)C(=O)NN |
| InChI | InChI=1S/C6H6N6O2/c7-1-3(5(13)11-9)4(2-8)6(14)12-10/h9-10H2,(H,11,13)(H,12,14)/b4-3+ |
| InChIKey | YXKUXBDSCNRUNM-ONEGZZNKSA-N |
| XLogP | -2.69 |
| TPSA | 157.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|