C21H21ClN2O2 — CID 8756406
N-[2-(3-chlorophenyl)ethyl]-2-[[(R)-furan-2-yl(phenyl)methyl]amino]acetamide (PubChem CID 8756406) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-[[(R)-furan-2-yl(phenyl)methyl]amino]acetamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-[[(R)-furan-2-yl(phenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 8756406 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-[[(R)-furan-2-yl(phenyl)methyl]amino]acetamide |
| SMILES | O=C(CN[C@H](c1ccccc1)c1ccco1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClN2O2/c22-18-9-4-6-16(14-18)11-12-23-20(25)15-24-21(19-10-5-13-26-19)17-7-2-1-3-8-17/h1-10,13-14,21,24H,11-12,15H2,(H,23,25)/t21-/m1/s1 |
| InChIKey | UVUQVJPFKKZMRX-OAQYLSRUSA-N |
| XLogP | 3.97 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |