C12H25N3O5 — CID 87564744
(2S)-6-amino-2-[[[(1S)-1-carboxypentyl]amino]-hydroxyamino]hexanoic acid (PubChem CID 87564744) has the molecular formula C12H25N3O5 and a molecular weight of 291.35 g/mol. Its IUPAC name is (2S)-6-amino-2-[[[(1S)-1-carboxypentyl]amino]-hydroxyamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[[(1S)-1-carboxypentyl]amino]-hydroxyamino]hexanoic acid |
|---|---|
| PubChem CID | 87564744 |
| Molecular Formula | C12H25N3O5 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2S)-6-amino-2-[[[(1S)-1-carboxypentyl]amino]-hydroxyamino]hexanoic acid |
| SMILES | CCCC[C@H](NN(O)[C@@H](CCCCN)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H25N3O5/c1-2-3-6-9(11(16)17)14-15(20)10(12(18)19)7-4-5-8-13/h9-10,14,20H,2-8,13H2,1H3,(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | SPIZPNKPOATXFB-UWVGGRQHSA-N |
| XLogP | 0.41 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|