C33H38F2N3O10P — CID 87567738
N-[3-(4-acetyl-2-nitrophenoxy)propyl]-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-2-formamido-2-phenylmethoxypropanamide (PubChem CID 87567738) has the molecular formula C33H38F2N3O10P and a molecular weight of 705.65 g/mol. Its IUPAC name is N-[3-(4-acetyl-2-nitrophenoxy)propyl]-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-2-formamido-2-phenylmethoxypropanamide.
| Compound Name | N-[3-(4-acetyl-2-nitrophenoxy)propyl]-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-2-formamido-2-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 87567738 |
| Molecular Formula | C33H38F2N3O10P |
| Molecular Weight | 705.65 g/mol |
| Exact Mass | 705.23 |
| IUPAC Name | N-[3-(4-acetyl-2-nitrophenoxy)propyl]-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-2-formamido-2-phenylmethoxypropanamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(CC(NC=O)(OCc2ccccc2)C(=O)NCCCOc2ccc(C(C)=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H38F2N3O10P/c1-4-47-49(44,48-5-2)33(34,35)28-15-12-25(13-16-28)21-32(37-23-39,46-22-26-10-7-6-8-11-26)31(41)36-18-9-19-45-30-17-14-27(24(3)40)20-29(30)38(42)43/h6-8,10-17,20,23H,4-5,9,18-19,21-22H2,1-3H3,(H,36,41)(H,37,39) |
| InChIKey | HIWWWFMFFYQVQS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|