C12H18O6 — CID 87570771
6-carboxyoxyoct-7-enyl ethenyl carbonate (PubChem CID 87570771) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 6-carboxyoxyoct-7-enyl ethenyl carbonate.
| Compound Name | 6-carboxyoxyoct-7-enyl ethenyl carbonate |
|---|---|
| PubChem CID | 87570771 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 6-carboxyoxyoct-7-enyl ethenyl carbonate |
| SMILES | C=COC(=O)OCCCCCC(C=C)OC(=O)O |
| InChI | InChI=1S/C12H18O6/c1-3-10(18-11(13)14)8-6-5-7-9-17-12(15)16-4-2/h3-4,10H,1-2,5-9H2,(H,13,14) |
| InChIKey | QCYBAMMBMNOVOG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|