About bis(tert-butyl(chloro)phosphane);dichloropalladium
bis(tert-butyl(chloro)phosphane);dichloropalladium (PubChem CID 87573042) has the molecular formula C8H20Cl4P2Pd
and a molecular weight of 426.43 g/mol. Its IUPAC name is bis(tert-butyl(chloro)phosphane);dichloropalladium.
Molecular Properties
| Compound Name | bis(tert-butyl(chloro)phosphane);dichloropalladium |
| PubChem CID | 87573042 |
| Molecular Formula | C8H20Cl4P2Pd |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 423.88 |
| IUPAC Name | bis(tert-butyl(chloro)phosphane);dichloropalladium |
| SMILES | CC(C)(C)PCl.CC(C)(C)PCl.Cl[Pd]Cl |
| InChI | InChI=1S/2C4H10ClP.2ClH.Pd/c2*1-4(2,3)6-5;;;/h2*6H,1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | BTKKBMGGCVFFQG-UHFFFAOYSA-L |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(tert-butyl(chloro)phosphane);dichloropalladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butyl(chloro)phosphane);dichloropalladium?
The IUPAC name of bis(tert-butyl(chloro)phosphane);dichloropalladium (CID 87573042) is bis(tert-butyl(chloro)phosphane);dichloropalladium.
What is the SMILES notation for bis(tert-butyl(chloro)phosphane);dichloropalladium?
The canonical SMILES for bis(tert-butyl(chloro)phosphane);dichloropalladium is CC(C)(C)PCl.CC(C)(C)PCl.Cl[Pd]Cl.
What is the InChIKey of bis(tert-butyl(chloro)phosphane);dichloropalladium?
The InChIKey is BTKKBMGGCVFFQG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H10ClP.2ClH.Pd/c2*1-4(2,3)6-5;;;/h2*6H,1-3H3;2*1H;/q;;;;+2/p-2.
What are the key properties of bis(tert-butyl(chloro)phosphane);dichloropalladium?
bis(tert-butyl(chloro)phosphane);dichloropalladium has a molecular weight of 426.43 g/mol, XLogP of 6.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butyl(chloro)phosphane);dichloropalladium is sourced from PubChem (CID 87573042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).