C13H9ClFN3O3 — CID 87576088
[5-[2-(2-chloropyrimidin-4-yl)acetyl]-2-fluorophenyl]carbamic acid (PubChem CID 87576088) has the molecular formula C13H9ClFN3O3 and a molecular weight of 309.68 g/mol. Its IUPAC name is [5-[2-(2-chloropyrimidin-4-yl)acetyl]-2-fluorophenyl]carbamic acid.
| Compound Name | [5-[2-(2-chloropyrimidin-4-yl)acetyl]-2-fluorophenyl]carbamic acid |
|---|---|
| PubChem CID | 87576088 |
| Molecular Formula | C13H9ClFN3O3 |
| Molecular Weight | 309.68 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | [5-[2-(2-chloropyrimidin-4-yl)acetyl]-2-fluorophenyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(C(=O)Cc2ccnc(Cl)n2)ccc1F |
| InChI | InChI=1S/C13H9ClFN3O3/c14-12-16-4-3-8(17-12)6-11(19)7-1-2-9(15)10(5-7)18-13(20)21/h1-5,18H,6H2,(H,20,21) |
| InChIKey | MWYOPFGNUPZRRZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |