C18H11ClF3N3OS — CID 163769693
2-(2-chloropyrimidin-4-yl)-1-[3-[(2,6-difluorophenyl)sulfanylamino]-4-fluorophenyl]ethanone (PubChem CID 163769693) has the molecular formula C18H11ClF3N3OS and a molecular weight of 409.82 g/mol. Its IUPAC name is 2-(2-chloropyrimidin-4-yl)-1-[3-[(2,6-difluorophenyl)sulfanylamino]-4-fluorophenyl]ethanone.
| Compound Name | 2-(2-chloropyrimidin-4-yl)-1-[3-[(2,6-difluorophenyl)sulfanylamino]-4-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 163769693 |
| Molecular Formula | C18H11ClF3N3OS |
| Molecular Weight | 409.82 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 2-(2-chloropyrimidin-4-yl)-1-[3-[(2,6-difluorophenyl)sulfanylamino]-4-fluorophenyl]ethanone |
| SMILES | O=C(Cc1ccnc(Cl)n1)c1ccc(F)c(NSc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C18H11ClF3N3OS/c19-18-23-7-6-11(24-18)9-16(26)10-4-5-12(20)15(8-10)25-27-17-13(21)2-1-3-14(17)22/h1-8,25H,9H2 |
| InChIKey | MFIWNEXENXUERT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|