C27H27N6O4+ — CID 87578124
methyl 4-[4-[(8-cyclopentyl-4-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]phenyl]-1-isocyanato-1-methylpyrrol-1-ium-2-carboxylate (PubChem CID 87578124) has the molecular formula C27H27N6O4+ and a molecular weight of 499.55 g/mol. Its IUPAC name is methyl 4-[4-[(8-cyclopentyl-4-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]phenyl]-1-isocyanato-1-methylpyrrol-1-ium-2-carboxylate.
| Compound Name | methyl 4-[4-[(8-cyclopentyl-4-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]phenyl]-1-isocyanato-1-methylpyrrol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 87578124 |
| Molecular Formula | C27H27N6O4+ |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | methyl 4-[4-[(8-cyclopentyl-4-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]phenyl]-1-isocyanato-1-methylpyrrol-1-ium-2-carboxylate |
| SMILES | COC(=O)C1=CC(c2ccc(Nc3nc(C)c4ccc(=O)n(C5CCCC5)c4n3)cc2)=C[N+]1(C)N=C=O |
| InChI | InChI=1S/C27H26N6O4/c1-17-22-12-13-24(35)32(21-6-4-5-7-21)25(22)31-27(29-17)30-20-10-8-18(9-11-20)19-14-23(26(36)37-3)33(2,15-19)28-16-34/h8-15,21H,4-7H2,1-3H3/p+1 |
| InChIKey | IDSVHHDUIQKCJS-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|