C19H38O5Si2 — CID 87580105
2,2,3,3-tetramethyl-6,6-bis[3-(oxiran-2-ylmethoxy)propyl]oxadisilinane (PubChem CID 87580105) has the molecular formula C19H38O5Si2 and a molecular weight of 402.68 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-6,6-bis[3-(oxiran-2-ylmethoxy)propyl]oxadisilinane.
| Compound Name | 2,2,3,3-tetramethyl-6,6-bis[3-(oxiran-2-ylmethoxy)propyl]oxadisilinane |
|---|---|
| PubChem CID | 87580105 |
| Molecular Formula | C19H38O5Si2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2,2,3,3-tetramethyl-6,6-bis[3-(oxiran-2-ylmethoxy)propyl]oxadisilinane |
| SMILES | C[Si]1(C)CCC(CCCOCC2CO2)(CCCOCC2CO2)O[Si]1(C)C |
| InChI | InChI=1S/C19H38O5Si2/c1-25(2)12-9-19(24-26(25,3)4,7-5-10-20-13-17-15-22-17)8-6-11-21-14-18-16-23-18/h17-18H,5-16H2,1-4H3 |
| InChIKey | QSJLEECVTLNXPM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|