C10H21N — CID 87580786
N-[(E)-but-1-enyl]-N,3-dimethylbutan-1-amine (PubChem CID 87580786) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is N-[(E)-but-1-enyl]-N,3-dimethylbutan-1-amine.
| Compound Name | N-[(E)-but-1-enyl]-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 87580786 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | N-[(E)-but-1-enyl]-N,3-dimethylbutan-1-amine |
| SMILES | CC/C=C/N(C)CCC(C)C |
| InChI | InChI=1S/C10H21N/c1-5-6-8-11(4)9-7-10(2)3/h6,8,10H,5,7,9H2,1-4H3/b8-6+ |
| InChIKey | KUNAEQCIDLNMCI-SOFGYWHQSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |