C33H20F6N2O12S2 — CID 87580949
[5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl] 4-methoxybenzenesulfonate (PubChem CID 87580949) has the molecular formula C33H20F6N2O12S2 and a molecular weight of 814.65 g/mol. Its IUPAC name is [5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl] 4-methoxybenzenesulfonate.
| Compound Name | [5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 87580949 |
| Molecular Formula | C33H20F6N2O12S2 |
| Molecular Weight | 814.65 g/mol |
| Exact Mass | 814.04 |
| IUPAC Name | [5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)ON2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(OS(=O)(=O)c4ccc(OC)cc4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)cc1 |
| InChI | InChI=1S/C33H20F6N2O12S2/c1-50-19-5-9-21(10-6-19)54(46,47)52-40-27(42)23-13-3-17(15-25(23)29(40)44)31(32(34,35)36,33(37,38)39)18-4-14-24-26(16-18)30(45)41(28(24)43)53-55(48,49)22-11-7-20(51-2)8-12-22/h3-16H,1-2H3 |
| InChIKey | HQDJRIOGGHPHGD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|