C13H11N3O2 — CID 87581944
8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,5,15-tetraene-12,14-dione (PubChem CID 87581944) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,5,15-tetraene-12,14-dione.
| Compound Name | 8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,5,15-tetraene-12,14-dione |
|---|---|
| PubChem CID | 87581944 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,5,15-tetraene-12,14-dione |
| SMILES | O=C1NC(=O)N2CC3NC4C=CC=CC4=C3C=C12 |
| InChI | InChI=1S/C13H11N3O2/c17-12-11-5-8-7-3-1-2-4-9(7)14-10(8)6-16(11)13(18)15-12/h1-5,9-10,14H,6H2,(H,15,17,18) |
| InChIKey | YZSBLFGQZMRVDK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|