C20H16F3N3O4 — CID 87582312
[[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carbonyl]-(pyridin-2-ylmethyl)amino] acetate (PubChem CID 87582312) has the molecular formula C20H16F3N3O4 and a molecular weight of 419.36 g/mol. Its IUPAC name is [[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carbonyl]-(pyridin-2-ylmethyl)amino] acetate.
| Compound Name | [[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carbonyl]-(pyridin-2-ylmethyl)amino] acetate |
|---|---|
| PubChem CID | 87582312 |
| Molecular Formula | C20H16F3N3O4 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carbonyl]-(pyridin-2-ylmethyl)amino] acetate |
| SMILES | CC(=O)ON(Cc1ccccn1)C(=O)c1nc(-c2cccc(C(F)(F)F)c2)oc1C |
| InChI | InChI=1S/C20H16F3N3O4/c1-12-17(19(28)26(30-13(2)27)11-16-8-3-4-9-24-16)25-18(29-12)14-6-5-7-15(10-14)20(21,22)23/h3-10H,11H2,1-2H3 |
| InChIKey | NANCIPIJXCLSAJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|