C20H23AsN4O2 — CID 87583326
CID 87583326 (PubChem CID 87583326) has the molecular formula C20H23AsN4O2 and a molecular weight of 426.35 g/mol.
| Compound Name | CID 87583326 |
|---|---|
| PubChem CID | 87583326 |
| Molecular Formula | C20H23AsN4O2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1nc(-c2cccc(C(=O)NCC3CCCCC3)c2)cnc1[As] |
| InChI | InChI=1S/C20H23AsN4O2/c1-22-20(27)17-18(21)23-12-16(25-17)14-8-5-9-15(10-14)19(26)24-11-13-6-3-2-4-7-13/h5,8-10,12-13H,2-4,6-7,11H2,1H3,(H,22,27)(H,24,26) |
| InChIKey | XZONSSCNFMEWSK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|