About hept-6-yne-2,4-diamine
hept-6-yne-2,4-diamine (PubChem CID 87584005) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is hept-6-yne-2,4-diamine.
Molecular Properties
| Compound Name | hept-6-yne-2,4-diamine |
| PubChem CID | 87584005 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | hept-6-yne-2,4-diamine |
| SMILES | C#CCC(N)CC(C)N |
| InChI | InChI=1S/C7H14N2/c1-3-4-7(9)5-6(2)8/h1,6-7H,4-5,8-9H2,2H3 |
| InChIKey | QHIFMUATKLMLSB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-6-yne-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-yne-2,4-diamine?
The IUPAC name of hept-6-yne-2,4-diamine (CID 87584005) is hept-6-yne-2,4-diamine.
What is the SMILES notation for hept-6-yne-2,4-diamine?
The canonical SMILES for hept-6-yne-2,4-diamine is C#CCC(N)CC(C)N.
What is the InChIKey of hept-6-yne-2,4-diamine?
The InChIKey is QHIFMUATKLMLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-4-7(9)5-6(2)8/h1,6-7H,4-5,8-9H2,2H3.
What are the key properties of hept-6-yne-2,4-diamine?
hept-6-yne-2,4-diamine has a molecular weight of 126.20 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-yne-2,4-diamine is sourced from PubChem (CID 87584005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).