C41H34O6S2 — CID 87584123
[2-methyl-4-[9-[3-methyl-4-(2-methylphenyl)sulfonyloxyphenyl]fluoren-9-yl]phenyl] 2-methylbenzenesulfonate (PubChem CID 87584123) has the molecular formula C41H34O6S2 and a molecular weight of 686.85 g/mol. Its IUPAC name is [2-methyl-4-[9-[3-methyl-4-(2-methylphenyl)sulfonyloxyphenyl]fluoren-9-yl]phenyl] 2-methylbenzenesulfonate.
| Compound Name | [2-methyl-4-[9-[3-methyl-4-(2-methylphenyl)sulfonyloxyphenyl]fluoren-9-yl]phenyl] 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87584123 |
| Molecular Formula | C41H34O6S2 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.18 |
| IUPAC Name | [2-methyl-4-[9-[3-methyl-4-(2-methylphenyl)sulfonyloxyphenyl]fluoren-9-yl]phenyl] 2-methylbenzenesulfonate |
| SMILES | Cc1cc(C2(c3ccc(OS(=O)(=O)c4ccccc4C)c(C)c3)c3ccccc3-c3ccccc32)ccc1OS(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C41H34O6S2/c1-27-13-5-11-19-39(27)48(42,43)46-37-23-21-31(25-29(37)3)41(35-17-9-7-15-33(35)34-16-8-10-18-36(34)41)32-22-24-38(30(4)26-32)47-49(44,45)40-20-12-6-14-28(40)2/h5-26H,1-4H3 |
| InChIKey | GDQORNWKVFEWQJ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|