C25H36N4O5 — CID 87589418
3-[(2R,3R)-3-[[1-(4-methoxybutyl)benzimidazole-2-carbonyl]-(2-methylpropyl)amino]oxiran-2-yl]piperidine-1-carboxylic acid (PubChem CID 87589418) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[(2R,3R)-3-[[1-(4-methoxybutyl)benzimidazole-2-carbonyl]-(2-methylpropyl)amino]oxiran-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(2R,3R)-3-[[1-(4-methoxybutyl)benzimidazole-2-carbonyl]-(2-methylpropyl)amino]oxiran-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87589418 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 3-[(2R,3R)-3-[[1-(4-methoxybutyl)benzimidazole-2-carbonyl]-(2-methylpropyl)amino]oxiran-2-yl]piperidine-1-carboxylic acid |
| SMILES | COCCCCn1c(C(=O)N(CC(C)C)[C@@H]2O[C@@H]2C2CCCN(C(=O)O)C2)nc2ccccc21 |
| InChI | InChI=1S/C25H36N4O5/c1-17(2)15-29(24-21(34-24)18-9-8-12-27(16-18)25(31)32)23(30)22-26-19-10-4-5-11-20(19)28(22)13-6-7-14-33-3/h4-5,10-11,17-18,21,24H,6-9,12-16H2,1-3H3,(H,31,32)/t18?,21-,24-/m1/s1 |
| InChIKey | YNMBAMMTENFQEK-QMFJJHEJSA-N |
| XLogP | 3.68 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|