C29H24F4O6S2 — CID 87590333
[4-[1-[3,5-difluoro-4-(2-methylphenyl)sulfonyloxyphenyl]propyl]-2,6-difluorophenyl] 2-methylbenzenesulfonate (PubChem CID 87590333) has the molecular formula C29H24F4O6S2 and a molecular weight of 608.63 g/mol. Its IUPAC name is [4-[1-[3,5-difluoro-4-(2-methylphenyl)sulfonyloxyphenyl]propyl]-2,6-difluorophenyl] 2-methylbenzenesulfonate.
| Compound Name | [4-[1-[3,5-difluoro-4-(2-methylphenyl)sulfonyloxyphenyl]propyl]-2,6-difluorophenyl] 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87590333 |
| Molecular Formula | C29H24F4O6S2 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | [4-[1-[3,5-difluoro-4-(2-methylphenyl)sulfonyloxyphenyl]propyl]-2,6-difluorophenyl] 2-methylbenzenesulfonate |
| SMILES | CCC(c1cc(F)c(OS(=O)(=O)c2ccccc2C)c(F)c1)c1cc(F)c(OS(=O)(=O)c2ccccc2C)c(F)c1 |
| InChI | InChI=1S/C29H24F4O6S2/c1-4-21(19-13-22(30)28(23(31)14-19)38-40(34,35)26-11-7-5-9-17(26)2)20-15-24(32)29(25(33)16-20)39-41(36,37)27-12-8-6-10-18(27)3/h5-16,21H,4H2,1-3H3 |
| InChIKey | NIBVVLDSXIHPTH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|