C39H42F2N4O7 — CID 87590591
tert-butyl N-[(2R,3S)-3-[[3-benzamido-5-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzoyl]amino]-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[(3-methoxyphenyl)methyl]carbamate (PubChem CID 87590591) has the molecular formula C39H42F2N4O7 and a molecular weight of 716.78 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3-[[3-benzamido-5-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzoyl]amino]-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[(3-methoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3-[[3-benzamido-5-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzoyl]amino]-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[(3-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 87590591 |
| Molecular Formula | C39H42F2N4O7 |
| Molecular Weight | 716.78 g/mol |
| Exact Mass | 716.30 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3-[[3-benzamido-5-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzoyl]amino]-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[(3-methoxyphenyl)methyl]carbamate |
| SMILES | COc1cccc(CN(C[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2cc(NC(=O)c3ccccc3)cc(/C(C)=N/O)c2)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C39H42F2N4O7/c1-24(44-50)28-18-29(20-32(19-28)42-36(47)27-11-7-6-8-12-27)37(48)43-34(17-26-14-30(40)21-31(41)15-26)35(46)23-45(38(49)52-39(2,3)4)22-25-10-9-13-33(16-25)51-5/h6-16,18-21,34-35,46,50H,17,22-23H2,1-5H3,(H,42,47)(H,43,48)/b44-24+/t34-,35+/m0/s1 |
| InChIKey | CNLKYWFZOALFRH-VJRDADGKSA-N |
| XLogP | 6.56 |
| TPSA | 149.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.78 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|