C35H34F2N4O7 — CID 173114987
[(2R,3S)-3-[[3-benzamido-5-(N-hydroxy-C-methylcarbonimidoyl)benzoyl]amino]-4-(3,5-difluorophenyl)-2-hydroxybutyl]-[(3-methoxyphenyl)methyl]carbamic acid (PubChem CID 173114987) has the molecular formula C35H34F2N4O7 and a molecular weight of 660.67 g/mol. Its IUPAC name is [(2R,3S)-3-[[3-benzamido-5-(N-hydroxy-C-methylcarbonimidoyl)benzoyl]amino]-4-(3,5-difluorophenyl)-2-hydroxybutyl]-[(3-methoxyphenyl)methyl]carbamic acid.
| Compound Name | [(2R,3S)-3-[[3-benzamido-5-(N-hydroxy-C-methylcarbonimidoyl)benzoyl]amino]-4-(3,5-difluorophenyl)-2-hydroxybutyl]-[(3-methoxyphenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 173114987 |
| Molecular Formula | C35H34F2N4O7 |
| Molecular Weight | 660.67 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | [(2R,3S)-3-[[3-benzamido-5-(N-hydroxy-C-methylcarbonimidoyl)benzoyl]amino]-4-(3,5-difluorophenyl)-2-hydroxybutyl]-[(3-methoxyphenyl)methyl]carbamic acid |
| SMILES | COc1cccc(CN(C[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2cc(NC(=O)c3ccccc3)cc(C(C)=NO)c2)C(=O)O)c1 |
| InChI | InChI=1S/C35H34F2N4O7/c1-21(40-47)25-15-26(17-29(16-25)38-33(43)24-8-4-3-5-9-24)34(44)39-31(14-23-11-27(36)18-28(37)12-23)32(42)20-41(35(45)46)19-22-7-6-10-30(13-22)48-2/h3-13,15-18,31-32,42,47H,14,19-20H2,1-2H3,(H,38,43)(H,39,44)(H,45,46)/t31-,32+/m0/s1 |
| InChIKey | XPVQNZYLYAGKHH-AJQTZOPKSA-N |
| XLogP | 5.31 |
| TPSA | 160.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|