C14H14N2O3S — CID 87591712
ethyl 2-amino-4-(2-formamidophenyl)thiophene-3-carboxylate (PubChem CID 87591712) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is ethyl 2-amino-4-(2-formamidophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-4-(2-formamidophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 87591712 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | ethyl 2-amino-4-(2-formamidophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2NC=O)csc1N |
| InChI | InChI=1S/C14H14N2O3S/c1-2-19-14(18)12-10(7-20-13(12)15)9-5-3-4-6-11(9)16-8-17/h3-8H,2,15H2,1H3,(H,16,17) |
| InChIKey | CPYIHKLKNIEKCN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|