C20H12N2O5S — CID 87592547
2-(1,3-dioxoisoindol-2-yl)-4-(2-formamidophenyl)thiophene-3-carboxylic acid (PubChem CID 87592547) has the molecular formula C20H12N2O5S and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-(2-formamidophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-(2-formamidophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 87592547 |
| Molecular Formula | C20H12N2O5S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-(2-formamidophenyl)thiophene-3-carboxylic acid |
| SMILES | O=CNc1ccccc1-c1csc(N2C(=O)c3ccccc3C2=O)c1C(=O)O |
| InChI | InChI=1S/C20H12N2O5S/c23-10-21-15-8-4-3-5-11(15)14-9-28-19(16(14)20(26)27)22-17(24)12-6-1-2-7-13(12)18(22)25/h1-10H,(H,21,23)(H,26,27) |
| InChIKey | WAUYOTYEOPYXAC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|