C12H8N2O5 — CID 717738
4-[(1,3-dioxoisoindol-2-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 717738) has the molecular formula C12H8N2O5 and a molecular weight of 260.21 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 717738 |
| Molecular Formula | C12H8N2O5 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H8N2O5/c15-9(5-6-10(16)17)13-14-11(18)7-3-1-2-4-8(7)12(14)19/h1-6H,(H,13,15)(H,16,17) |
| InChIKey | WRVJSYIFBDBZJF-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|