C19H9F6N3O6 — CID 102448171
5-(1,3-dioxoisoindol-2-yl)-2,4-bis[(2,2,2-trifluoroacetyl)amino]benzoic acid (PubChem CID 102448171) has the molecular formula C19H9F6N3O6 and a molecular weight of 489.28 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)-2,4-bis[(2,2,2-trifluoroacetyl)amino]benzoic acid.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)-2,4-bis[(2,2,2-trifluoroacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 102448171 |
| Molecular Formula | C19H9F6N3O6 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)-2,4-bis[(2,2,2-trifluoroacetyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)c3ccccc3C2=O)c(NC(=O)C(F)(F)F)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H9F6N3O6/c20-18(21,22)16(33)26-10-6-11(27-17(34)19(23,24)25)12(5-9(10)15(31)32)28-13(29)7-3-1-2-4-8(7)14(28)30/h1-6H,(H,26,33)(H,27,34)(H,31,32) |
| InChIKey | YTVKMZLDYRTFSJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|