C15H34O7Si2 — CID 87594651
3,5-dimethyl-1,7-bis(trimethoxysilyl)heptan-4-one (PubChem CID 87594651) has the molecular formula C15H34O7Si2 and a molecular weight of 382.60 g/mol. Its IUPAC name is 3,5-dimethyl-1,7-bis(trimethoxysilyl)heptan-4-one.
| Compound Name | 3,5-dimethyl-1,7-bis(trimethoxysilyl)heptan-4-one |
|---|---|
| PubChem CID | 87594651 |
| Molecular Formula | C15H34O7Si2 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3,5-dimethyl-1,7-bis(trimethoxysilyl)heptan-4-one |
| SMILES | CO[Si](CCC(C)C(=O)C(C)CC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C15H34O7Si2/c1-13(9-11-23(17-3,18-4)19-5)15(16)14(2)10-12-24(20-6,21-7)22-8/h13-14H,9-12H2,1-8H3 |
| InChIKey | NWERDIYYGIRSTE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|