C27H58O7Si2 — CID 87595580
9,11-dimethyl-9,11-bis(trimethoxysilyl)nonadecan-10-one (PubChem CID 87595580) has the molecular formula C27H58O7Si2 and a molecular weight of 550.93 g/mol. Its IUPAC name is 9,11-dimethyl-9,11-bis(trimethoxysilyl)nonadecan-10-one.
| Compound Name | 9,11-dimethyl-9,11-bis(trimethoxysilyl)nonadecan-10-one |
|---|---|
| PubChem CID | 87595580 |
| Molecular Formula | C27H58O7Si2 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | 9,11-dimethyl-9,11-bis(trimethoxysilyl)nonadecan-10-one |
| SMILES | CCCCCCCCC(C)(C(=O)C(C)(CCCCCCCC)[Si](OC)(OC)OC)[Si](OC)(OC)OC |
| InChI | InChI=1S/C27H58O7Si2/c1-11-13-15-17-19-21-23-26(3,35(29-5,30-6)31-7)25(28)27(4,36(32-8,33-9)34-10)24-22-20-18-16-14-12-2/h11-24H2,1-10H3 |
| InChIKey | MEGSNMZRHHCARJ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|