C21H46O7Si2 — CID 87595221
5,7-diethyl-5,7-bis(trimethoxysilyl)undecan-6-one (PubChem CID 87595221) has the molecular formula C21H46O7Si2 and a molecular weight of 466.76 g/mol. Its IUPAC name is 5,7-diethyl-5,7-bis(trimethoxysilyl)undecan-6-one.
| Compound Name | 5,7-diethyl-5,7-bis(trimethoxysilyl)undecan-6-one |
|---|---|
| PubChem CID | 87595221 |
| Molecular Formula | C21H46O7Si2 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 5,7-diethyl-5,7-bis(trimethoxysilyl)undecan-6-one |
| SMILES | CCCCC(CC)(C(=O)C(CC)(CCCC)[Si](OC)(OC)OC)[Si](OC)(OC)OC |
| InChI | InChI=1S/C21H46O7Si2/c1-11-15-17-20(13-3,29(23-5,24-6)25-7)19(22)21(14-4,18-16-12-2)30(26-8,27-9)28-10/h11-18H2,1-10H3 |
| InChIKey | PGVYTBKRGGNPNJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|