C53H110O19Si2 — CID 87655672
9,11-diethyl-9,11-bis[tris[1-(1-methoxyethoxy)ethoxy]silyl]nonadecan-10-one (PubChem CID 87655672) has the molecular formula C53H110O19Si2 and a molecular weight of 1107.62 g/mol. Its IUPAC name is 9,11-diethyl-9,11-bis[tris[1-(1-methoxyethoxy)ethoxy]silyl]nonadecan-10-one.
| Compound Name | 9,11-diethyl-9,11-bis[tris[1-(1-methoxyethoxy)ethoxy]silyl]nonadecan-10-one |
|---|---|
| PubChem CID | 87655672 |
| Molecular Formula | C53H110O19Si2 |
| Molecular Weight | 1107.62 g/mol |
| Exact Mass | 1106.72 |
| IUPAC Name | 9,11-diethyl-9,11-bis[tris[1-(1-methoxyethoxy)ethoxy]silyl]nonadecan-10-one |
| SMILES | CCCCCCCCC(CC)(C(=O)C(CC)(CCCCCCCC)[Si](OC(C)OC(C)OC)(OC(C)OC(C)OC)OC(C)OC(C)OC)[Si](OC(C)OC(C)OC)(OC(C)OC(C)OC)OC(C)OC(C)OC |
| InChI | InChI=1S/C53H110O19Si2/c1-23-27-29-31-33-35-37-52(25-3,73(67-45(11)61-39(5)55-17,68-46(12)62-40(6)56-18)69-47(13)63-41(7)57-19)51(54)53(26-4,38-36-34-32-30-28-24-2)74(70-48(14)64-42(8)58-20,71-49(15)65-43(9)59-21)72-50(16)66-44(10)60-22/h39-50H,23-38H2,1-22H3 |
| InChIKey | IUJWQZDIBWHXLE-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 183.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.62 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|