C27H54O10 — CID 87812958
3-ethyl-2,2,3-tris[1-(1-methoxyethoxy)ethoxy]decanal (PubChem CID 87812958) has the molecular formula C27H54O10 and a molecular weight of 538.72 g/mol. Its IUPAC name is 3-ethyl-2,2,3-tris[1-(1-methoxyethoxy)ethoxy]decanal.
| Compound Name | 3-ethyl-2,2,3-tris[1-(1-methoxyethoxy)ethoxy]decanal |
|---|---|
| PubChem CID | 87812958 |
| Molecular Formula | C27H54O10 |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | 3-ethyl-2,2,3-tris[1-(1-methoxyethoxy)ethoxy]decanal |
| SMILES | CCCCCCCC(CC)(OC(C)OC(C)OC)C(C=O)(OC(C)OC(C)OC)OC(C)OC(C)OC |
| InChI | InChI=1S/C27H54O10/c1-12-14-15-16-17-18-26(13-2,35-23(6)32-20(3)29-9)27(19-28,36-24(7)33-21(4)30-10)37-25(8)34-22(5)31-11/h19-25H,12-18H2,1-11H3 |
| InChIKey | SRSSJWMGEBWDNJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|