C28H28N2O3S — CID 87599268
benzyl 6-[2-(3-methoxyphenyl)ethyl]-4-(4-methylphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 87599268) has the molecular formula C28H28N2O3S and a molecular weight of 472.61 g/mol. Its IUPAC name is benzyl 6-[2-(3-methoxyphenyl)ethyl]-4-(4-methylphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | benzyl 6-[2-(3-methoxyphenyl)ethyl]-4-(4-methylphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 87599268 |
| Molecular Formula | C28H28N2O3S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | benzyl 6-[2-(3-methoxyphenyl)ethyl]-4-(4-methylphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COc1cccc(CCC2=C(C(=O)OCc3ccccc3)C(c3ccc(C)cc3)NC(=S)N2)c1 |
| InChI | InChI=1S/C28H28N2O3S/c1-19-11-14-22(15-12-19)26-25(27(31)33-18-21-7-4-3-5-8-21)24(29-28(34)30-26)16-13-20-9-6-10-23(17-20)32-2/h3-12,14-15,17,26H,13,16,18H2,1-2H3,(H2,29,30,34) |
| InChIKey | IZCNVJMUGAUVCJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|