C11H14N2O5 — CID 87600320
[(3S)-1-(2-methoxy-3,4-dioxocyclobuten-1-yl)piperidin-3-yl]carbamic acid (PubChem CID 87600320) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is [(3S)-1-(2-methoxy-3,4-dioxocyclobuten-1-yl)piperidin-3-yl]carbamic acid.
| Compound Name | [(3S)-1-(2-methoxy-3,4-dioxocyclobuten-1-yl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87600320 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [(3S)-1-(2-methoxy-3,4-dioxocyclobuten-1-yl)piperidin-3-yl]carbamic acid |
| SMILES | COc1c(N2CCC[C@H](NC(=O)O)C2)c(=O)c1=O |
| InChI | InChI=1S/C11H14N2O5/c1-18-10-7(8(14)9(10)15)13-4-2-3-6(5-13)12-11(16)17/h6,12H,2-5H2,1H3,(H,16,17)/t6-/m0/s1 |
| InChIKey | AXPHDNPDZOQTAA-LURJTMIESA-N |
| XLogP | -0.47 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|