C14H18IN5O2 — CID 139413882
[1-(5-amino-3-iodo-2-methylindazol-4-yl)piperidin-3-yl]carbamic acid (PubChem CID 139413882) has the molecular formula C14H18IN5O2 and a molecular weight of 415.24 g/mol. Its IUPAC name is [1-(5-amino-3-iodo-2-methylindazol-4-yl)piperidin-3-yl]carbamic acid.
| Compound Name | [1-(5-amino-3-iodo-2-methylindazol-4-yl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 139413882 |
| Molecular Formula | C14H18IN5O2 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [1-(5-amino-3-iodo-2-methylindazol-4-yl)piperidin-3-yl]carbamic acid |
| SMILES | Cn1nc2ccc(N)c(N3CCCC(NC(=O)O)C3)c2c1I |
| InChI | InChI=1S/C14H18IN5O2/c1-19-13(15)11-10(18-19)5-4-9(16)12(11)20-6-2-3-8(7-20)17-14(21)22/h4-5,8,17H,2-3,6-7,16H2,1H3,(H,21,22) |
| InChIKey | ADYZLLNPEKQPJT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|