C30H38ClN3O4 — CID 87600590
N-[(3S)-4-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-[(E)-3-(dimethylamino)prop-2-enoyl]benzamide (PubChem CID 87600590) has the molecular formula C30H38ClN3O4 and a molecular weight of 540.10 g/mol. Its IUPAC name is N-[(3S)-4-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-[(E)-3-(dimethylamino)prop-2-enoyl]benzamide.
| Compound Name | N-[(3S)-4-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-[(E)-3-(dimethylamino)prop-2-enoyl]benzamide |
|---|---|
| PubChem CID | 87600590 |
| Molecular Formula | C30H38ClN3O4 |
| Molecular Weight | 540.10 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | N-[(3S)-4-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-[(E)-3-(dimethylamino)prop-2-enoyl]benzamide |
| SMILES | C[C@@H](CN1CC[C@](O)(c2ccc(Cl)cc2)C(C)(C)C1)C(C=O)NC(=O)c1cccc(C(=O)/C=C/N(C)C)c1 |
| InChI | InChI=1S/C30H38ClN3O4/c1-21(18-34-16-14-30(38,29(2,3)20-34)24-9-11-25(31)12-10-24)26(19-35)32-28(37)23-8-6-7-22(17-23)27(36)13-15-33(4)5/h6-13,15,17,19,21,26,38H,14,16,18,20H2,1-5H3,(H,32,37)/b15-13+/t21-,26?,30-/m0/s1 |
| InChIKey | KTVNPNHKNVOUHP-KVOQTDAUSA-N |
| XLogP | 4.15 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.10 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|